C29H25N5O3 — CID 10278142
9-[(1S,2R,4R,5S)-4-(trityloxymethyl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]purin-6-amine (PubChem CID 10278142) has the molecular formula C29H25N5O3 and a molecular weight of 491.55 g/mol. Its IUPAC name is 9-[(1S,2R,4R,5S)-4-(trityloxymethyl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]purin-6-amine.
| Compound Name | 9-[(1S,2R,4R,5S)-4-(trityloxymethyl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 10278142 |
| Molecular Formula | C29H25N5O3 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 9-[(1S,2R,4R,5S)-4-(trityloxymethyl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C29H25N5O3/c30-26-23-27(32-17-31-26)34(18-33-23)28-25-24(37-25)22(36-28)16-35-29(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,17-18,22,24-25,28H,16H2,(H2,30,31,32)/t22-,24+,25+,28-/m1/s1 |
| InChIKey | OIUKFGYIZRVMAN-FQFFBEATSA-N |
| XLogP | 4.08 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|