C19H19N5O4 — CID 170896648
[(2S,3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol (PubChem CID 170896648) has the molecular formula C19H19N5O4 and a molecular weight of 381.39 g/mol. Its IUPAC name is [(2S,3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(2S,3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 170896648 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | [(2S,3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@H]2O[C@H](/C=C/c3ccccc3)O[C@H]21 |
| InChI | InChI=1S/C19H19N5O4/c20-17-14-18(22-9-21-17)24(10-23-14)19-16-15(12(8-25)26-19)27-13(28-16)7-6-11-4-2-1-3-5-11/h1-7,9-10,12-13,15-16,19,25H,8H2,(H2,20,21,22)/b7-6+/t12-,13+,15-,16-,19-/m1/s1 |
| InChIKey | FEKMTCKNDJQGCB-AZXOCPPLSA-N |
| XLogP | 1.12 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |