C32H31N5O7S — CID 10168168
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-methylsulfonyloxy-2-(trityloxymethyl)oxolan-3-yl] acetate (PubChem CID 10168168) has the molecular formula C32H31N5O7S and a molecular weight of 629.70 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-methylsulfonyloxy-2-(trityloxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-methylsulfonyloxy-2-(trityloxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 10168168 |
| Molecular Formula | C32H31N5O7S |
| Molecular Weight | 629.70 g/mol |
| Exact Mass | 629.19 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-methylsulfonyloxy-2-(trityloxymethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OS(C)(=O)=O)[C@H](n2cnc3c(N)ncnc32)O[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H31N5O7S/c1-21(38)42-27-25(43-31(28(27)44-45(2,39)40)37-20-36-26-29(33)34-19-35-30(26)37)18-41-32(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-17,19-20,25,27-28,31H,18H2,1-2H3,(H2,33,34,35)/t25-,27+,28-,31-/m1/s1 |
| InChIKey | KBHQLRGEUHVIMP-JDCTXFJWSA-N |
| XLogP | 3.59 |
| TPSA | 157.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.70 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|