C43H39N5O10 — CID 175676895
4-[(2R,3R,4R,5R)-4-acetyloxy-2-(6-benzamidopurin-9-yl)-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-3-yl]oxy-4-oxobutanoic acid (PubChem CID 175676895) has the molecular formula C43H39N5O10 and a molecular weight of 785.81 g/mol. Its IUPAC name is 4-[(2R,3R,4R,5R)-4-acetyloxy-2-(6-benzamidopurin-9-yl)-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-3-yl]oxy-4-oxobutanoic acid.
| Compound Name | 4-[(2R,3R,4R,5R)-4-acetyloxy-2-(6-benzamidopurin-9-yl)-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-3-yl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 175676895 |
| Molecular Formula | C43H39N5O10 |
| Molecular Weight | 785.81 g/mol |
| Exact Mass | 785.27 |
| IUPAC Name | 4-[(2R,3R,4R,5R)-4-acetyloxy-2-(6-benzamidopurin-9-yl)-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-3-yl]oxy-4-oxobutanoic acid |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)[C@H](OC(=O)CCC(=O)O)[C@@H]2OC(C)=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C43H39N5O10/c1-27(49)56-37-33(24-55-43(29-14-8-4-9-15-29,30-16-10-5-11-17-30)31-18-20-32(54-2)21-19-31)57-42(38(37)58-35(52)23-22-34(50)51)48-26-46-36-39(44-25-45-40(36)48)47-41(53)28-12-6-3-7-13-28/h3-21,25-26,33,37-38,42H,22-24H2,1-2H3,(H,50,51)(H,44,45,47,53)/t33-,37-,38-,42-/m1/s1 |
| InChIKey | LIGQAHJWOCJGQI-FXTDJBBPSA-N |
| XLogP | 5.70 |
| TPSA | 190.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.81 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|