C38H37FN6O8P+ — CID 172818346
azane;[(2R,3S,4S,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-fluorooxolan-3-yl]oxy-hydroxy-oxophosphanium (PubChem CID 172818346) has the molecular formula C38H37FN6O8P+ and a molecular weight of 755.72 g/mol. Its IUPAC name is azane;[(2R,3S,4S,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-fluorooxolan-3-yl]oxy-hydroxy-oxophosphanium.
| Compound Name | azane;[(2R,3S,4S,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-fluorooxolan-3-yl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 172818346 |
| Molecular Formula | C38H37FN6O8P+ |
| Molecular Weight | 755.72 g/mol |
| Exact Mass | 755.24 |
| IUPAC Name | azane;[(2R,3S,4S,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-fluorooxolan-3-yl]oxy-hydroxy-oxophosphanium |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)[C@@H](F)[C@H]2O[P+](=O)O)(c2ccccc2)c2ccc(OC)cc2)cc1.N |
| InChI | InChI=1S/C38H33FN5O8P.H3N/c1-48-28-17-13-26(14-18-28)38(25-11-7-4-8-12-25,27-15-19-29(49-2)20-16-27)50-21-30-33(52-53(46)47)31(39)37(51-30)44-23-42-32-34(40-22-41-35(32)44)43-36(45)24-9-5-3-6-10-24;/h3-20,22-23,30-31,33,37H,21H2,1-2H3,(H-,40,41,43,45,46,47);1H3/p+1/t30-,31+,33+,37-;/m1./s1 |
| InChIKey | JDRJDLUQFARCQL-CPRVOUNASA-O |
| XLogP | 6.54 |
| TPSA | 191.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.72 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|