C31H31N5O6PS+ — CID 177408767
[(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-oxo-sulfanylphosphanium (PubChem CID 177408767) has the molecular formula C31H31N5O6PS+ and a molecular weight of 632.66 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-oxo-sulfanylphosphanium.
| Compound Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-oxo-sulfanylphosphanium |
|---|---|
| PubChem CID | 177408767 |
| Molecular Formula | C31H31N5O6PS+ |
| Molecular Weight | 632.66 g/mol |
| Exact Mass | 632.17 |
| IUPAC Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-oxo-sulfanylphosphanium |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)C[C@@H]2O[P+](=O)S)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H30N5O6PS/c1-38-23-12-8-21(9-13-23)31(20-6-4-3-5-7-20,22-10-14-24(39-2)15-11-22)40-17-26-25(42-43(37)44)16-27(41-26)36-19-35-28-29(32)33-18-34-30(28)36/h3-15,18-19,25-27H,16-17H2,1-2H3,(H2-,32,33,34,37,44)/p+1/t25-,26+,27+/m0/s1 |
| InChIKey | CZZMESZMYHICLQ-OYUWMTPXSA-O |
| XLogP | 5.69 |
| TPSA | 132.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.66 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|