C34H37N3O6 — CID 87409018
1-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-(hydroxyamino)-5-propylpyrimidin-2-one (PubChem CID 87409018) has the molecular formula C34H37N3O6 and a molecular weight of 583.69 g/mol. Its IUPAC name is 1-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-(hydroxyamino)-5-propylpyrimidin-2-one.
| Compound Name | 1-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-(hydroxyamino)-5-propylpyrimidin-2-one |
|---|---|
| PubChem CID | 87409018 |
| Molecular Formula | C34H37N3O6 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | 1-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-(hydroxyamino)-5-propylpyrimidin-2-one |
| SMILES | CCCc1cn([C@@H]2O[C@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@H]3OC(C)(C)O[C@H]32)c(=O)nc1NO |
| InChI | InChI=1S/C34H37N3O6/c1-4-14-23-21-37(32(38)35-30(23)36-39)31-29-28(42-33(2,3)43-29)27(41-31)22-40-34(24-15-8-5-9-16-24,25-17-10-6-11-18-25)26-19-12-7-13-20-26/h5-13,15-21,27-29,31,39H,4,14,22H2,1-3H3,(H,35,36,38)/t27-,28-,29-,31-/m1/s1 |
| InChIKey | RURWNVPURYQCSK-BUVRPPHQSA-N |
| XLogP | 5.42 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|