C19H31N3O8 — CID 167251593
1-[(3aR,4R,6R,6aR)-6-[(2-ethyl-1-hydroxy-2-methoxybutoxy)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-(hydroxyamino)pyrimidin-2-one (PubChem CID 167251593) has the molecular formula C19H31N3O8 and a molecular weight of 429.47 g/mol. Its IUPAC name is 1-[(3aR,4R,6R,6aR)-6-[(2-ethyl-1-hydroxy-2-methoxybutoxy)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-(hydroxyamino)pyrimidin-2-one.
| Compound Name | 1-[(3aR,4R,6R,6aR)-6-[(2-ethyl-1-hydroxy-2-methoxybutoxy)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-(hydroxyamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 167251593 |
| Molecular Formula | C19H31N3O8 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 1-[(3aR,4R,6R,6aR)-6-[(2-ethyl-1-hydroxy-2-methoxybutoxy)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-(hydroxyamino)pyrimidin-2-one |
| SMILES | CCC(CC)(OC)C(O)OC[C@H]1O[C@@H](n2ccc(NO)nc2=O)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C19H31N3O8/c1-6-19(7-2,26-5)16(23)27-10-11-13-14(30-18(3,4)29-13)15(28-11)22-9-8-12(21-25)20-17(22)24/h8-9,11,13-16,23,25H,6-7,10H2,1-5H3,(H,20,21,24)/t11-,13-,14-,15-,16?/m1/s1 |
| InChIKey | VVOQJKRFJYJGNJ-ALTVCHKUSA-N |
| XLogP | 1.00 |
| TPSA | 133.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|