C16H19N3O9 — CID 166560371
[(4aR,5R,7R,7aR)-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]-2,3-dioxo-4a,5,7,7a-tetrahydrofuro[3,4-b][1,4]dioxin-7-yl]methyl (2S)-2-methylbutanoate (PubChem CID 166560371) has the molecular formula C16H19N3O9 and a molecular weight of 397.34 g/mol. Its IUPAC name is [(4aR,5R,7R,7aR)-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]-2,3-dioxo-4a,5,7,7a-tetrahydrofuro[3,4-b][1,4]dioxin-7-yl]methyl (2S)-2-methylbutanoate.
| Compound Name | [(4aR,5R,7R,7aR)-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]-2,3-dioxo-4a,5,7,7a-tetrahydrofuro[3,4-b][1,4]dioxin-7-yl]methyl (2S)-2-methylbutanoate |
|---|---|
| PubChem CID | 166560371 |
| Molecular Formula | C16H19N3O9 |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | [(4aR,5R,7R,7aR)-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]-2,3-dioxo-4a,5,7,7a-tetrahydrofuro[3,4-b][1,4]dioxin-7-yl]methyl (2S)-2-methylbutanoate |
| SMILES | CC[C@H](C)C(=O)OC[C@H]1O[C@@H](n2ccc(NO)nc2=O)[C@@H]2OC(=O)C(=O)O[C@@H]21 |
| InChI | InChI=1S/C16H19N3O9/c1-3-7(2)13(20)25-6-8-10-11(28-15(22)14(21)27-10)12(26-8)19-5-4-9(18-24)17-16(19)23/h4-5,7-8,10-12,24H,3,6H2,1-2H3,(H,17,18,23)/t7-,8+,10+,11+,12+/m0/s1 |
| InChIKey | XXZHIKLRDWNNQA-RULNCXCMSA-N |
| XLogP | -0.63 |
| TPSA | 155.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|