C22H21N3O9 — CID 167279368
[(1R,3R,3aR,11aR)-3-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]-5,10-dioxo-1,3,3a,11a-tetrahydrofuro[3,4-c][2,5]benzodioxocin-1-yl]methyl pent-4-enoate (PubChem CID 167279368) has the molecular formula C22H21N3O9 and a molecular weight of 471.42 g/mol. Its IUPAC name is [(1R,3R,3aR,11aR)-3-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]-5,10-dioxo-1,3,3a,11a-tetrahydrofuro[3,4-c][2,5]benzodioxocin-1-yl]methyl pent-4-enoate.
| Compound Name | [(1R,3R,3aR,11aR)-3-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]-5,10-dioxo-1,3,3a,11a-tetrahydrofuro[3,4-c][2,5]benzodioxocin-1-yl]methyl pent-4-enoate |
|---|---|
| PubChem CID | 167279368 |
| Molecular Formula | C22H21N3O9 |
| Molecular Weight | 471.42 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | [(1R,3R,3aR,11aR)-3-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]-5,10-dioxo-1,3,3a,11a-tetrahydrofuro[3,4-c][2,5]benzodioxocin-1-yl]methyl pent-4-enoate |
| SMILES | C=CCCC(=O)OC[C@H]1O[C@@H](n2ccc(NO)nc2=O)[C@@H]2OC(=O)c3ccccc3C(=O)O[C@@H]21 |
| InChI | InChI=1S/C22H21N3O9/c1-2-3-8-16(26)31-11-14-17-18(19(32-14)25-10-9-15(24-30)23-22(25)29)34-21(28)13-7-5-4-6-12(13)20(27)33-17/h2,4-7,9-10,14,17-19,30H,1,3,8,11H2,(H,23,24,29)/t14-,17-,18-,19-/m1/s1 |
| InChIKey | XJZLHXAVRPYHHA-UTRMSSBJSA-N |
| XLogP | 1.22 |
| TPSA | 155.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|