C21H27N3O10 — CID 171724826
[(5R,7R)-5-[4-(2-methylpropanoyloxyamino)-2-oxopyrimidin-1-yl]-2,3-dioxo-4a,5,7,7a-tetrahydrofuro[3,4-b][1,4]dioxin-7-yl]methyl hexanoate (PubChem CID 171724826) has the molecular formula C21H27N3O10 and a molecular weight of 481.46 g/mol. Its IUPAC name is [(5R,7R)-5-[4-(2-methylpropanoyloxyamino)-2-oxopyrimidin-1-yl]-2,3-dioxo-4a,5,7,7a-tetrahydrofuro[3,4-b][1,4]dioxin-7-yl]methyl hexanoate.
| Compound Name | [(5R,7R)-5-[4-(2-methylpropanoyloxyamino)-2-oxopyrimidin-1-yl]-2,3-dioxo-4a,5,7,7a-tetrahydrofuro[3,4-b][1,4]dioxin-7-yl]methyl hexanoate |
|---|---|
| PubChem CID | 171724826 |
| Molecular Formula | C21H27N3O10 |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | [(5R,7R)-5-[4-(2-methylpropanoyloxyamino)-2-oxopyrimidin-1-yl]-2,3-dioxo-4a,5,7,7a-tetrahydrofuro[3,4-b][1,4]dioxin-7-yl]methyl hexanoate |
| SMILES | CCCCCC(=O)OC[C@H]1O[C@@H](n2ccc(NOC(=O)C(C)C)nc2=O)C2OC(=O)C(=O)OC21 |
| InChI | InChI=1S/C21H27N3O10/c1-4-5-6-7-14(25)30-10-12-15-16(33-20(28)19(27)32-15)17(31-12)24-9-8-13(22-21(24)29)23-34-18(26)11(2)3/h8-9,11-12,15-17H,4-7,10H2,1-3H3,(H,22,23,29)/t12-,15?,16?,17-/m1/s1 |
| InChIKey | XDKRKRHMIVIOKQ-BOSFTKNMSA-N |
| XLogP | 0.63 |
| TPSA | 161.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|