C23H24N4O10 — CID 171724854
[(5R,7R)-5-[4-[[(2R)-2-amino-3-methylbutanoyl]oxyamino]-2-oxopyrimidin-1-yl]-2,3-dioxo-4a,5,7,7a-tetrahydrofuro[3,4-b][1,4]dioxin-7-yl]methyl benzoate (PubChem CID 171724854) has the molecular formula C23H24N4O10 and a molecular weight of 516.46 g/mol. Its IUPAC name is [(5R,7R)-5-[4-[[(2R)-2-amino-3-methylbutanoyl]oxyamino]-2-oxopyrimidin-1-yl]-2,3-dioxo-4a,5,7,7a-tetrahydrofuro[3,4-b][1,4]dioxin-7-yl]methyl benzoate.
| Compound Name | [(5R,7R)-5-[4-[[(2R)-2-amino-3-methylbutanoyl]oxyamino]-2-oxopyrimidin-1-yl]-2,3-dioxo-4a,5,7,7a-tetrahydrofuro[3,4-b][1,4]dioxin-7-yl]methyl benzoate |
|---|---|
| PubChem CID | 171724854 |
| Molecular Formula | C23H24N4O10 |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | [(5R,7R)-5-[4-[[(2R)-2-amino-3-methylbutanoyl]oxyamino]-2-oxopyrimidin-1-yl]-2,3-dioxo-4a,5,7,7a-tetrahydrofuro[3,4-b][1,4]dioxin-7-yl]methyl benzoate |
| SMILES | CC(C)[C@@H](N)C(=O)ONc1ccn([C@@H]2O[C@H](COC(=O)c3ccccc3)C3OC(=O)C(=O)OC32)c(=O)n1 |
| InChI | InChI=1S/C23H24N4O10/c1-11(2)15(24)20(29)37-26-14-8-9-27(23(32)25-14)18-17-16(35-21(30)22(31)36-17)13(34-18)10-33-19(28)12-6-4-3-5-7-12/h3-9,11,13,15-18H,10,24H2,1-2H3,(H,25,26,32)/t13-,15-,16?,17?,18-/m1/s1 |
| InChIKey | NFBOMUGQDPQTHS-WZJUOUGFSA-N |
| XLogP | -0.31 |
| TPSA | 187.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|