C21H22N4O10 — CID 166560402
[[1-[(1R,3R,3aR,11aR)-1-(hydroxymethyl)-5,10-dioxo-1,3,3a,11a-tetrahydrofuro[3,4-c][2,5]benzodioxocin-3-yl]-2-oxopyrimidin-4-yl]amino] (3R)-2-amino-3-hydroxybutanoate (PubChem CID 166560402) has the molecular formula C21H22N4O10 and a molecular weight of 490.43 g/mol. Its IUPAC name is [[1-[(1R,3R,3aR,11aR)-1-(hydroxymethyl)-5,10-dioxo-1,3,3a,11a-tetrahydrofuro[3,4-c][2,5]benzodioxocin-3-yl]-2-oxopyrimidin-4-yl]amino] (3R)-2-amino-3-hydroxybutanoate.
| Compound Name | [[1-[(1R,3R,3aR,11aR)-1-(hydroxymethyl)-5,10-dioxo-1,3,3a,11a-tetrahydrofuro[3,4-c][2,5]benzodioxocin-3-yl]-2-oxopyrimidin-4-yl]amino] (3R)-2-amino-3-hydroxybutanoate |
|---|---|
| PubChem CID | 166560402 |
| Molecular Formula | C21H22N4O10 |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | [[1-[(1R,3R,3aR,11aR)-1-(hydroxymethyl)-5,10-dioxo-1,3,3a,11a-tetrahydrofuro[3,4-c][2,5]benzodioxocin-3-yl]-2-oxopyrimidin-4-yl]amino] (3R)-2-amino-3-hydroxybutanoate |
| SMILES | C[C@@H](O)C(N)C(=O)ONc1ccn([C@@H]2O[C@H](CO)[C@H]3OC(=O)c4ccccc4C(=O)O[C@H]32)c(=O)n1 |
| InChI | InChI=1S/C21H22N4O10/c1-9(27)14(22)20(30)35-24-13-6-7-25(21(31)23-13)17-16-15(12(8-26)32-17)33-18(28)10-4-2-3-5-11(10)19(29)34-16/h2-7,9,12,14-17,26-27H,8,22H2,1H3,(H,23,24,31)/t9-,12-,14?,15-,16-,17-/m1/s1 |
| InChIKey | KBNVLYZULWIMIQ-WRYMVZNYSA-N |
| XLogP | -1.52 |
| TPSA | 201.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|