C18H21N3O7 — CID 167529533
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl 3-phenylpropanoate (PubChem CID 167529533) has the molecular formula C18H21N3O7 and a molecular weight of 391.38 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl 3-phenylpropanoate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl 3-phenylpropanoate |
|---|---|
| PubChem CID | 167529533 |
| Molecular Formula | C18H21N3O7 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl 3-phenylpropanoate |
| SMILES | O=C(CCc1ccccc1)OC[C@H]1O[C@@H](n2ccc(NO)nc2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H21N3O7/c22-14(7-6-11-4-2-1-3-5-11)27-10-12-15(23)16(24)17(28-12)21-9-8-13(20-26)19-18(21)25/h1-5,8-9,12,15-17,23-24,26H,6-7,10H2,(H,19,20,25)/t12-,15-,16-,17-/m1/s1 |
| InChIKey | UNLPWQLRBCCFPQ-BASLNEPJSA-N |
| XLogP | -0.16 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|