C20H31N3O8 — CID 58492744
[(2R,3S,4S,5R)-3,4-dihydroxy-5-[4-(methylamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl 10-hydroxy-9-oxodecanoate (PubChem CID 58492744) has the molecular formula C20H31N3O8 and a molecular weight of 441.48 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4-dihydroxy-5-[4-(methylamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl 10-hydroxy-9-oxodecanoate.
| Compound Name | [(2R,3S,4S,5R)-3,4-dihydroxy-5-[4-(methylamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl 10-hydroxy-9-oxodecanoate |
|---|---|
| PubChem CID | 58492744 |
| Molecular Formula | C20H31N3O8 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4-dihydroxy-5-[4-(methylamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl 10-hydroxy-9-oxodecanoate |
| SMILES | CNc1ccn([C@@H]2O[C@H](COC(=O)CCCCCCCC(=O)CO)[C@@H](O)[C@@H]2O)c(=O)n1 |
| InChI | InChI=1S/C20H31N3O8/c1-21-15-9-10-23(20(29)22-15)19-18(28)17(27)14(31-19)12-30-16(26)8-6-4-2-3-5-7-13(25)11-24/h9-10,14,17-19,24,27-28H,2-8,11-12H2,1H3,(H,21,22,29)/t14-,17-,18+,19-/m1/s1 |
| InChIKey | SVYCVXCWFXCDQI-DQEVTTJGSA-N |
| XLogP | -0.26 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|