C10H14Cl2N3O6P — CID 123936779
1-[5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-4-(methylamino)pyrimidin-2-one (PubChem CID 123936779) has the molecular formula C10H14Cl2N3O6P and a molecular weight of 374.12 g/mol. Its IUPAC name is 1-[5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-4-(methylamino)pyrimidin-2-one.
| Compound Name | 1-[5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-4-(methylamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 123936779 |
| Molecular Formula | C10H14Cl2N3O6P |
| Molecular Weight | 374.12 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 1-[5-(dichlorophosphoryloxymethyl)-3,4-dihydroxyoxolan-2-yl]-4-(methylamino)pyrimidin-2-one |
| SMILES | CNc1ccn(C2OC(COP(=O)(Cl)Cl)C(O)C2O)c(=O)n1 |
| InChI | InChI=1S/C10H14Cl2N3O6P/c1-13-6-2-3-15(10(18)14-6)9-8(17)7(16)5(21-9)4-20-22(11,12)19/h2-3,5,7-9,16-17H,4H2,1H3,(H,13,14,18) |
| InChIKey | HSYRAHOGQBOMIU-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.12 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|