C19H29N3O8 — CID 58492713
[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 10-hydroxy-9-oxodecanoate (PubChem CID 58492713) has the molecular formula C19H29N3O8 and a molecular weight of 427.45 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 10-hydroxy-9-oxodecanoate.
| Compound Name | [(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 10-hydroxy-9-oxodecanoate |
|---|---|
| PubChem CID | 58492713 |
| Molecular Formula | C19H29N3O8 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | [(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 10-hydroxy-9-oxodecanoate |
| SMILES | Nc1ccn([C@@H]2O[C@H](COC(=O)CCCCCCCC(=O)CO)[C@@H](O)[C@@H]2O)c(=O)n1 |
| InChI | InChI=1S/C19H29N3O8/c20-14-8-9-22(19(28)21-14)18-17(27)16(26)13(30-18)11-29-15(25)7-5-3-1-2-4-6-12(24)10-23/h8-9,13,16-18,23,26-27H,1-7,10-11H2,(H2,20,21,28)/t13-,16-,17+,18-/m1/s1 |
| InChIKey | AJWSQDKUJUIWCD-NKGKWGDASA-N |
| XLogP | -0.72 |
| TPSA | 174.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|