C12H17N4O7Se — CID 155606810
CID 155606810 (PubChem CID 155606810) has the molecular formula C12H17N4O7Se and a molecular weight of 408.25 g/mol.
| Compound Name | CID 155606810 |
|---|---|
| PubChem CID | 155606810 |
| Molecular Formula | C12H17N4O7Se |
| Molecular Weight | 408.25 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | — |
| SMILES | N[C@H](C[Se])C(=O)OC[C@H]1O[C@@H](n2ccc(NO)nc2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H17N4O7Se/c13-5(4-24)11(19)22-3-6-8(17)9(18)10(23-6)16-2-1-7(15-21)14-12(16)20/h1-2,5-6,8-10,17-18,21H,3-4,13H2,(H,14,15,20)/t5-,6-,8-,9-,10-/m1/s1 |
| InChIKey | CJZIBWJDAKKRQH-PKGQWCBFSA-N |
| XLogP | -2.88 |
| TPSA | 169.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.25 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|