C18H27N3O8 — CID 167279375
[(3aR,4R,6R,6aR)-4-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 2,2-dimethylpropyl carbonate (PubChem CID 167279375) has the molecular formula C18H27N3O8 and a molecular weight of 413.43 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 2,2-dimethylpropyl carbonate.
| Compound Name | [(3aR,4R,6R,6aR)-4-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 2,2-dimethylpropyl carbonate |
|---|---|
| PubChem CID | 167279375 |
| Molecular Formula | C18H27N3O8 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 2,2-dimethylpropyl carbonate |
| SMILES | CC(C)(C)COC(=O)OC[C@H]1O[C@@H](n2ccc(NO)nc2=O)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C18H27N3O8/c1-17(2,3)9-26-16(23)25-8-10-12-13(29-18(4,5)28-12)14(27-10)21-7-6-11(20-24)19-15(21)22/h6-7,10,12-14,24H,8-9H2,1-5H3,(H,19,20,22)/t10-,12-,13-,14-/m1/s1 |
| InChIKey | AYHWUOSNJIQWJP-FMKGYKFTSA-N |
| XLogP | 1.66 |
| TPSA | 130.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|