C18H32N2O6Si2 — CID 22215217
1-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(trimethylsilyloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-trimethylsilyloxypyrimidin-2-one (PubChem CID 22215217) has the molecular formula C18H32N2O6Si2 and a molecular weight of 428.63 g/mol. Its IUPAC name is 1-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(trimethylsilyloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-trimethylsilyloxypyrimidin-2-one.
| Compound Name | 1-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(trimethylsilyloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-trimethylsilyloxypyrimidin-2-one |
|---|---|
| PubChem CID | 22215217 |
| Molecular Formula | C18H32N2O6Si2 |
| Molecular Weight | 428.63 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 1-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(trimethylsilyloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-trimethylsilyloxypyrimidin-2-one |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO[Si](C)(C)C)O[C@H]2n1ccc(O[Si](C)(C)C)nc1=O |
| InChI | InChI=1S/C18H32N2O6Si2/c1-18(2)24-14-12(11-22-27(3,4)5)23-16(15(14)25-18)20-10-9-13(19-17(20)21)26-28(6,7)8/h9-10,12,14-16H,11H2,1-8H3/t12-,14-,15-,16-/m1/s1 |
| InChIKey | UBCUFUABDIWMIX-DTZQCDIJSA-N |
| XLogP | 2.73 |
| TPSA | 81.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.63 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|