C25H36N2O8SSi — CID 101063801
[1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-oxopyrimidin-4-yl] 4-methylbenzenesulfonate (PubChem CID 101063801) has the molecular formula C25H36N2O8SSi and a molecular weight of 552.72 g/mol. Its IUPAC name is [1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-oxopyrimidin-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-oxopyrimidin-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101063801 |
| Molecular Formula | C25H36N2O8SSi |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | [1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-oxopyrimidin-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccn([C@@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]4OC(C)(C)O[C@H]43)c(=O)n2)cc1 |
| InChI | InChI=1S/C25H36N2O8SSi/c1-16-9-11-17(12-10-16)36(29,30)35-19-13-14-27(23(28)26-19)22-21-20(33-25(5,6)34-21)18(32-22)15-31-37(7,8)24(2,3)4/h9-14,18,20-22H,15H2,1-8H3/t18-,20-,21-,22-/m1/s1 |
| InChIKey | YRVKDDZRSVKNFN-ZHHKINOHSA-N |
| XLogP | 3.76 |
| TPSA | 115.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|