C26H35N3O4Si — CID 44626945
[(3aR,4R,6R,6aR)-2,2-dimethyl-4-(4-phenylpyrrolo[2,3-d]pyrimidin-7-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 44626945) has the molecular formula C26H35N3O4Si and a molecular weight of 481.67 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-2,2-dimethyl-4-(4-phenylpyrrolo[2,3-d]pyrimidin-7-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4R,6R,6aR)-2,2-dimethyl-4-(4-phenylpyrrolo[2,3-d]pyrimidin-7-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 44626945 |
| Molecular Formula | C26H35N3O4Si |
| Molecular Weight | 481.67 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | [(3aR,4R,6R,6aR)-2,2-dimethyl-4-(4-phenylpyrrolo[2,3-d]pyrimidin-7-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H]2n1ccc2c(-c3ccccc3)ncnc21 |
| InChI | InChI=1S/C26H35N3O4Si/c1-25(2,3)34(6,7)30-15-19-21-22(33-26(4,5)32-21)24(31-19)29-14-13-18-20(27-16-28-23(18)29)17-11-9-8-10-12-17/h8-14,16,19,21-22,24H,15H2,1-7H3/t19-,21-,22-,24-/m1/s1 |
| InChIKey | CSCMOUDEEHNNED-VDEHWKIFSA-N |
| XLogP | 5.54 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.67 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|