C43H39N5O4 — CID 140961311
7-[[(3aR,4R,6R)-2,2-dimethyl-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-N-tritylquinolin-2-amine (PubChem CID 140961311) has the molecular formula C43H39N5O4 and a molecular weight of 689.82 g/mol. Its IUPAC name is 7-[[(3aR,4R,6R)-2,2-dimethyl-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-N-tritylquinolin-2-amine.
| Compound Name | 7-[[(3aR,4R,6R)-2,2-dimethyl-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-N-tritylquinolin-2-amine |
|---|---|
| PubChem CID | 140961311 |
| Molecular Formula | C43H39N5O4 |
| Molecular Weight | 689.82 g/mol |
| Exact Mass | 689.30 |
| IUPAC Name | 7-[[(3aR,4R,6R)-2,2-dimethyl-4-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-N-tritylquinolin-2-amine |
| SMILES | Cc1ncnc2c1ccn2[C@@H]1O[C@H](COc2ccc3ccc(NC(c4ccccc4)(c4ccccc4)c4ccccc4)nc3c2)C2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C43H39N5O4/c1-28-34-23-24-48(40(34)45-27-44-28)41-39-38(51-42(2,3)52-39)36(50-41)26-49-33-21-19-29-20-22-37(46-35(29)25-33)47-43(30-13-7-4-8-14-30,31-15-9-5-10-16-31)32-17-11-6-12-18-32/h4-25,27,36,38-39,41H,26H2,1-3H3,(H,46,47)/t36-,38?,39-,41-/m1/s1 |
| InChIKey | AHXDNEGFJAWCPQ-ARDVWVMYSA-N |
| XLogP | 8.19 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.82 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|