C25H24ClN5O3 — CID 138688344
7-[[(3aR,6R,6aS)-6-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]methoxy]-N-methylquinolin-2-amine (PubChem CID 138688344) has the molecular formula C25H24ClN5O3 and a molecular weight of 477.95 g/mol. Its IUPAC name is 7-[[(3aR,6R,6aS)-6-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]methoxy]-N-methylquinolin-2-amine.
| Compound Name | 7-[[(3aR,6R,6aS)-6-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]methoxy]-N-methylquinolin-2-amine |
|---|---|
| PubChem CID | 138688344 |
| Molecular Formula | C25H24ClN5O3 |
| Molecular Weight | 477.95 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 7-[[(3aR,6R,6aS)-6-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]methoxy]-N-methylquinolin-2-amine |
| SMILES | CNc1ccc2ccc(OCC3=C[C@@H](n4ccc5c(Cl)ncnc54)[C@@H]4OC(C)(C)O[C@H]34)cc2n1 |
| InChI | InChI=1S/C25H24ClN5O3/c1-25(2)33-21-15(12-32-16-6-4-14-5-7-20(27-3)30-18(14)11-16)10-19(22(21)34-25)31-9-8-17-23(26)28-13-29-24(17)31/h4-11,13,19,21-22H,12H2,1-3H3,(H,27,30)/t19-,21-,22+/m1/s1 |
| InChIKey | DVAYBASXMXHYRE-FCEUIQTBSA-N |
| XLogP | 4.75 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.95 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|