C24H24ClN5O4 — CID 126637880
(2R,3R,4S,5R)-2-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-5-[[2-(cyclopropylmethylamino)quinolin-7-yl]oxymethyl]oxolane-3,4-diol (PubChem CID 126637880) has the molecular formula C24H24ClN5O4 and a molecular weight of 481.94 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-5-[[2-(cyclopropylmethylamino)quinolin-7-yl]oxymethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-5-[[2-(cyclopropylmethylamino)quinolin-7-yl]oxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 126637880 |
| Molecular Formula | C24H24ClN5O4 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | (2R,3R,4S,5R)-2-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-5-[[2-(cyclopropylmethylamino)quinolin-7-yl]oxymethyl]oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H](COc2ccc3ccc(NCC4CC4)nc3c2)O[C@H]1n1ccc2c(Cl)ncnc21 |
| InChI | InChI=1S/C24H24ClN5O4/c25-22-16-7-8-30(23(16)28-12-27-22)24-21(32)20(31)18(34-24)11-33-15-5-3-14-4-6-19(29-17(14)9-15)26-10-13-1-2-13/h3-9,12-13,18,20-21,24,31-32H,1-2,10-11H2,(H,26,29)/t18-,20-,21-,24-/m1/s1 |
| InChIKey | AOUOAUJYCSFQLH-UMCMBGNQSA-N |
| XLogP | 3.15 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |