C22H24N6O4 — CID 140901665
(2R,3S,4R,5R)-2-[(2-aminoquinolin-7-yl)oxymethyl]-5-[4-(dimethylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol (PubChem CID 140901665) has the molecular formula C22H24N6O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[(2-aminoquinolin-7-yl)oxymethyl]-5-[4-(dimethylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[(2-aminoquinolin-7-yl)oxymethyl]-5-[4-(dimethylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 140901665 |
| Molecular Formula | C22H24N6O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (2R,3S,4R,5R)-2-[(2-aminoquinolin-7-yl)oxymethyl]-5-[4-(dimethylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol |
| SMILES | CN(C)c1ncnc2c1ccn2[C@@H]1O[C@H](COc2ccc3ccc(N)nc3c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H24N6O4/c1-27(2)20-14-7-8-28(21(14)25-11-24-20)22-19(30)18(29)16(32-22)10-31-13-5-3-12-4-6-17(23)26-15(12)9-13/h3-9,11,16,18-19,22,29-30H,10H2,1-2H3,(H2,23,26)/t16-,18-,19-,22-/m1/s1 |
| InChIKey | BHMDLLDQFOCPBN-WGQQHEPDSA-N |
| XLogP | 1.33 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |