C22H22N6O4 — CID 137479699
(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[(2-aminoquinolin-7-yl)oxymethyl]-3-ethenyloxolane-3,4-diol (PubChem CID 137479699) has the molecular formula C22H22N6O4 and a molecular weight of 434.46 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[(2-aminoquinolin-7-yl)oxymethyl]-3-ethenyloxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[(2-aminoquinolin-7-yl)oxymethyl]-3-ethenyloxolane-3,4-diol |
|---|---|
| PubChem CID | 137479699 |
| Molecular Formula | C22H22N6O4 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | (2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[(2-aminoquinolin-7-yl)oxymethyl]-3-ethenyloxolane-3,4-diol |
| SMILES | C=C[C@@]1(O)[C@@H](COc2ccc3ccc(N)nc3c2)O[C@@H](n2ccc3c(N)ncnc32)[C@@H]1O |
| InChI | InChI=1S/C22H22N6O4/c1-2-22(30)16(10-31-13-5-3-12-4-6-17(23)27-15(12)9-13)32-21(18(22)29)28-8-7-14-19(24)25-11-26-20(14)28/h2-9,11,16,18,21,29-30H,1,10H2,(H2,23,27)(H2,24,25,26)/t16-,18+,21-,22-/m1/s1 |
| InChIKey | MWFLCEUDWRURTE-XNKSBNDBSA-N |
| XLogP | 1.40 |
| TPSA | 154.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|