C22H20N6O2 — CID 137490903
7-[[5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-ethynyloxolan-2-yl]methoxy]quinolin-2-amine (PubChem CID 137490903) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 7-[[5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-ethynyloxolan-2-yl]methoxy]quinolin-2-amine.
| Compound Name | 7-[[5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-ethynyloxolan-2-yl]methoxy]quinolin-2-amine |
|---|---|
| PubChem CID | 137490903 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 7-[[5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-ethynyloxolan-2-yl]methoxy]quinolin-2-amine |
| SMILES | C#CC1CC(n2ccc3c(N)ncnc32)OC1COc1ccc2ccc(N)nc2c1 |
| InChI | InChI=1S/C22H20N6O2/c1-2-13-9-20(28-8-7-16-21(24)25-12-26-22(16)28)30-18(13)11-29-15-5-3-14-4-6-19(23)27-17(14)10-15/h1,3-8,10,12-13,18,20H,9,11H2,(H2,23,27)(H2,24,25,26) |
| InChIKey | CRCPSLHSVFFYDY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|