C23H22N6O2 — CID 166942521
7-[[(5R)-5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-3-methyloxolan-2-yl]methoxy]quinolin-2-amine (PubChem CID 166942521) has the molecular formula C23H22N6O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is 7-[[(5R)-5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-3-methyloxolan-2-yl]methoxy]quinolin-2-amine.
| Compound Name | 7-[[(5R)-5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-3-methyloxolan-2-yl]methoxy]quinolin-2-amine |
|---|---|
| PubChem CID | 166942521 |
| Molecular Formula | C23H22N6O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 7-[[(5R)-5-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-3-methyloxolan-2-yl]methoxy]quinolin-2-amine |
| SMILES | C#Cc1cn([C@H]2CC(C)C(COc3ccc4ccc(N)nc4c3)O2)c2ncnc(N)c12 |
| InChI | InChI=1S/C23H22N6O2/c1-3-14-10-29(23-21(14)22(25)26-12-27-23)20-8-13(2)18(31-20)11-30-16-6-4-15-5-7-19(24)28-17(15)9-16/h1,4-7,9-10,12-13,18,20H,8,11H2,2H3,(H2,24,28)(H2,25,26,27)/t13?,18?,20-/m1/s1 |
| InChIKey | WJQWSZGYUMBMOA-KJHMKFEISA-N |
| XLogP | 3.13 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|