C22H22N7O4+ — CID 156730077
[(2R,3R,4S,5R)-2-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(2-aminoquinolin-7-yl)oxymethyl]-3,4-dihydroxyoxolan-2-yl]-methylidyneazanium (PubChem CID 156730077) has the molecular formula C22H22N7O4+ and a molecular weight of 448.46 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-2-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(2-aminoquinolin-7-yl)oxymethyl]-3,4-dihydroxyoxolan-2-yl]-methylidyneazanium.
| Compound Name | [(2R,3R,4S,5R)-2-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(2-aminoquinolin-7-yl)oxymethyl]-3,4-dihydroxyoxolan-2-yl]-methylidyneazanium |
|---|---|
| PubChem CID | 156730077 |
| Molecular Formula | C22H22N7O4+ |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | [(2R,3R,4S,5R)-2-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(2-aminoquinolin-7-yl)oxymethyl]-3,4-dihydroxyoxolan-2-yl]-methylidyneazanium |
| SMILES | C#[N+][C@@]1(n2cc(C)c3c(N)ncnc32)O[C@H](COc2ccc3ccc(N)nc3c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H22N7O4/c1-11-8-29(21-17(11)20(24)26-10-27-21)22(25-2)19(31)18(30)15(33-22)9-32-13-5-3-12-4-6-16(23)28-14(12)7-13/h2-8,10,15,18-19,30-31H,9H2,1H3,(H2,23,28)(H2,24,26,27)/q+1/t15-,18-,19-,22+/m1/s1 |
| InChIKey | KPGVYLKOZSHJMT-YHFKFMBFSA-N |
| XLogP | 1.22 |
| TPSA | 158.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |