C25H27FN6O4 — CID 164570044
1-[4-amino-7-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-[[2-(methylamino)quinolin-7-yl]oxymethyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]butan-1-one (PubChem CID 164570044) has the molecular formula C25H27FN6O4 and a molecular weight of 494.53 g/mol. Its IUPAC name is 1-[4-amino-7-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-[[2-(methylamino)quinolin-7-yl]oxymethyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]butan-1-one.
| Compound Name | 1-[4-amino-7-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-[[2-(methylamino)quinolin-7-yl]oxymethyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]butan-1-one |
|---|---|
| PubChem CID | 164570044 |
| Molecular Formula | C25H27FN6O4 |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 1-[4-amino-7-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-[[2-(methylamino)quinolin-7-yl]oxymethyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]butan-1-one |
| SMILES | CCCC(=O)c1cn([C@@H]2O[C@H](COc3ccc4ccc(NC)nc4c3)[C@@H](O)[C@@H]2F)c2ncnc(N)c12 |
| InChI | InChI=1S/C25H27FN6O4/c1-3-4-17(33)15-10-32(24-20(15)23(27)29-12-30-24)25-21(26)22(34)18(36-25)11-35-14-7-5-13-6-8-19(28-2)31-16(13)9-14/h5-10,12,18,21-22,25,34H,3-4,11H2,1-2H3,(H,28,31)(H2,27,29,30)/t18-,21+,22-,25-/m1/s1 |
| InChIKey | NZWWSIRCSOACHD-LALUYCJQSA-N |
| XLogP | 3.26 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |