C13H14N4O3 — CID 138579625
(2R,3R,5S)-2-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-5-(hydroxymethyl)oxolan-3-ol (PubChem CID 138579625) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is (2R,3R,5S)-2-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-5-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,5S)-2-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-5-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 138579625 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (2R,3R,5S)-2-(4-amino-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl)-5-(hydroxymethyl)oxolan-3-ol |
| SMILES | C#Cc1cn([C@@H]2O[C@H](CO)C[C@H]2O)c2ncnc(N)c12 |
| InChI | InChI=1S/C13H14N4O3/c1-2-7-4-17(12-10(7)11(14)15-6-16-12)13-9(19)3-8(5-18)20-13/h1,4,6,8-9,13,18-19H,3,5H2,(H2,14,15,16)/t8-,9+,13+/m0/s1 |
| InChIKey | GPLSGSIYCJDEQI-IGJMFERPSA-N |
| XLogP | -0.36 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|