C21H17Cl2FN4O2 — CID 142528235
2-chloro-7-[[5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-3-methyloxolan-2-yl]methoxy]quinoline (PubChem CID 142528235) has the molecular formula C21H17Cl2FN4O2 and a molecular weight of 447.30 g/mol. Its IUPAC name is 2-chloro-7-[[5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-3-methyloxolan-2-yl]methoxy]quinoline.
| Compound Name | 2-chloro-7-[[5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-3-methyloxolan-2-yl]methoxy]quinoline |
|---|---|
| PubChem CID | 142528235 |
| Molecular Formula | C21H17Cl2FN4O2 |
| Molecular Weight | 447.30 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 2-chloro-7-[[5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-3-methyloxolan-2-yl]methoxy]quinoline |
| SMILES | CC1CC(n2cc(F)c3c(Cl)ncnc32)OC1COc1ccc2ccc(Cl)nc2c1 |
| InChI | InChI=1S/C21H17Cl2FN4O2/c1-11-6-18(28-8-14(24)19-20(23)25-10-26-21(19)28)30-16(11)9-29-13-4-2-12-3-5-17(22)27-15(12)7-13/h2-5,7-8,10-11,16,18H,6,9H2,1H3 |
| InChIKey | IYZOTAXNLPPXMI-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.30 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|