C21H17Cl2FN4O4 — CID 137491008
(2R,3S,4R,5R)-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-2-[(2-chloroquinolin-7-yl)oxymethyl]-3-methyloxolane-3,4-diol (PubChem CID 137491008) has the molecular formula C21H17Cl2FN4O4 and a molecular weight of 479.30 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-2-[(2-chloroquinolin-7-yl)oxymethyl]-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-2-[(2-chloroquinolin-7-yl)oxymethyl]-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 137491008 |
| Molecular Formula | C21H17Cl2FN4O4 |
| Molecular Weight | 479.30 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | (2R,3S,4R,5R)-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-2-[(2-chloroquinolin-7-yl)oxymethyl]-3-methyloxolane-3,4-diol |
| SMILES | C[C@@]1(O)[C@@H](COc2ccc3ccc(Cl)nc3c2)O[C@@H](n2cc(F)c3c(Cl)ncnc32)[C@@H]1O |
| InChI | InChI=1S/C21H17Cl2FN4O4/c1-21(30)14(8-31-11-4-2-10-3-5-15(22)27-13(10)6-11)32-20(17(21)29)28-7-12(24)16-18(23)25-9-26-19(16)28/h2-7,9,14,17,20,29-30H,8H2,1H3/t14-,17+,20-,21-/m1/s1 |
| InChIKey | UBMPCALGLGUFGU-GYPMPWGGSA-N |
| XLogP | 3.51 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|