C15H15ClFN3O3 — CID 138688017
[(3aR,6R,6aS)-6-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]methanol (PubChem CID 138688017) has the molecular formula C15H15ClFN3O3 and a molecular weight of 339.75 g/mol. Its IUPAC name is [(3aR,6R,6aS)-6-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]methanol.
| Compound Name | [(3aR,6R,6aS)-6-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]methanol |
|---|---|
| PubChem CID | 138688017 |
| Molecular Formula | C15H15ClFN3O3 |
| Molecular Weight | 339.75 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | [(3aR,6R,6aS)-6-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]methanol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)C(CO)=C[C@H]2n1cc(F)c2c(Cl)ncnc21 |
| InChI | InChI=1S/C15H15ClFN3O3/c1-15(2)22-11-7(5-21)3-9(12(11)23-15)20-4-8(17)10-13(16)18-6-19-14(10)20/h3-4,6,9,11-12,21H,5H2,1-2H3/t9-,11-,12+/m1/s1 |
| InChIKey | RNKNVBWFSCNQDU-JLLWLGSASA-N |
| XLogP | 2.22 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.75 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|