C15H15ClIN3O2 — CID 155399344
7-[(3aR,6R,6aS)-4-(iodomethyl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-4-chloropyrrolo[2,3-d]pyrimidine (PubChem CID 155399344) has the molecular formula C15H15ClIN3O2 and a molecular weight of 431.66 g/mol. Its IUPAC name is 7-[(3aR,6R,6aS)-4-(iodomethyl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-4-chloropyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-[(3aR,6R,6aS)-4-(iodomethyl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-4-chloropyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 155399344 |
| Molecular Formula | C15H15ClIN3O2 |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 430.99 |
| IUPAC Name | 7-[(3aR,6R,6aS)-4-(iodomethyl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-4-chloropyrrolo[2,3-d]pyrimidine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)C(CI)=C[C@H]2n1ccc2c(Cl)ncnc21 |
| InChI | InChI=1S/C15H15ClIN3O2/c1-15(2)21-11-8(6-17)5-10(12(11)22-15)20-4-3-9-13(16)18-7-19-14(9)20/h3-5,7,10-12H,6H2,1-2H3/t10-,11-,12+/m1/s1 |
| InChIKey | KWWMRZXMGBIAIM-UTUOFQBUSA-N |
| XLogP | 3.52 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|