C18H21N3O2 — CID 138687982
7-[(3aR,6R,6aS)-4-ethenyl-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-4-ethylpyrrolo[2,3-d]pyrimidine (PubChem CID 138687982) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 7-[(3aR,6R,6aS)-4-ethenyl-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-4-ethylpyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-[(3aR,6R,6aS)-4-ethenyl-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-4-ethylpyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 138687982 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 7-[(3aR,6R,6aS)-4-ethenyl-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-4-ethylpyrrolo[2,3-d]pyrimidine |
| SMILES | C=CC1=C[C@@H](n2ccc3c(CC)ncnc32)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C18H21N3O2/c1-5-11-9-14(16-15(11)22-18(3,4)23-16)21-8-7-12-13(6-2)19-10-20-17(12)21/h5,7-10,14-16H,1,6H2,2-4H3/t14-,15-,16+/m1/s1 |
| InChIKey | HIBFLOGXFIARBM-OAGGEKHMSA-N |
| XLogP | 3.18 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |