C15H16ClN3O2S — CID 146347428
7-[(3aR,4R,6aS)-6-ethenyl-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]-4-chloropyrrolo[2,3-d]pyrimidine (PubChem CID 146347428) has the molecular formula C15H16ClN3O2S and a molecular weight of 337.83 g/mol. Its IUPAC name is 7-[(3aR,4R,6aS)-6-ethenyl-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]-4-chloropyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-[(3aR,4R,6aS)-6-ethenyl-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]-4-chloropyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 146347428 |
| Molecular Formula | C15H16ClN3O2S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 7-[(3aR,4R,6aS)-6-ethenyl-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]-4-chloropyrrolo[2,3-d]pyrimidine |
| SMILES | C=CC1S[C@@H](n2ccc3c(Cl)ncnc32)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C15H16ClN3O2S/c1-4-9-10-11(21-15(2,3)20-10)14(22-9)19-6-5-8-12(16)17-7-18-13(8)19/h4-7,9-11,14H,1H2,2-3H3/t9?,10-,11-,14-/m1/s1 |
| InChIKey | UETMZOCXZXSKSP-HQEXMQBPSA-N |
| XLogP | 3.40 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|