C18H19ClIN3O2 — CID 138687995
4-chloro-7-[(1R,2R,4S,5R,6S)-2-[(E)-2-iodoprop-1-enyl]-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]pyrrolo[2,3-d]pyrimidine (PubChem CID 138687995) has the molecular formula C18H19ClIN3O2 and a molecular weight of 471.73 g/mol. Its IUPAC name is 4-chloro-7-[(1R,2R,4S,5R,6S)-2-[(E)-2-iodoprop-1-enyl]-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]pyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-chloro-7-[(1R,2R,4S,5R,6S)-2-[(E)-2-iodoprop-1-enyl]-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 138687995 |
| Molecular Formula | C18H19ClIN3O2 |
| Molecular Weight | 471.73 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | 4-chloro-7-[(1R,2R,4S,5R,6S)-2-[(E)-2-iodoprop-1-enyl]-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]pyrrolo[2,3-d]pyrimidine |
| SMILES | C/C(I)=C\[C@@]12C[C@@H]1[C@@H](n1ccc3c(Cl)ncnc31)[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C18H19ClIN3O2/c1-9(20)6-18-7-11(18)12(13-14(18)25-17(2,3)24-13)23-5-4-10-15(19)21-8-22-16(10)23/h4-6,8,11-14H,7H2,1-3H3/b9-6+/t11-,12-,13+,14+,18-/m1/s1 |
| InChIKey | HWDNIUKYSBFQQZ-BOYXOPAFSA-N |
| XLogP | 4.50 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.73 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|