C15H18ClN3O4 — CID 167995218
(PubChem CID 167995218) has the molecular formula C15H18ClN3O4 and a molecular weight of 339.78 g/mol.
| Compound Name | |
|---|---|
| PubChem CID | 167995218 |
| Molecular Formula | C15H18ClN3O4 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | — |
| SMILES | CC1(C)OC2C(n3ccc4c(Cl)ncnc43)OC(CO)C2(C)O1 |
| InChI | InChI=1S/C15H18ClN3O4/c1-14(2)22-10-13(21-9(6-20)15(10,3)23-14)19-5-4-8-11(16)17-7-18-12(8)19/h4-5,7,9-10,13,20H,6H2,1-3H3 |
| InChIKey | DCHUHHXGELQWQZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |