C22H23Cl2N3O4 — CID 137479731
[(3aR,4R,6R,6aR)-6-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]-(4-chloro-3-methylphenyl)methanol (PubChem CID 137479731) has the molecular formula C22H23Cl2N3O4 and a molecular weight of 464.35 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-6-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]-(4-chloro-3-methylphenyl)methanol.
| Compound Name | [(3aR,4R,6R,6aR)-6-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]-(4-chloro-3-methylphenyl)methanol |
|---|---|
| PubChem CID | 137479731 |
| Molecular Formula | C22H23Cl2N3O4 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | [(3aR,4R,6R,6aR)-6-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]-(4-chloro-3-methylphenyl)methanol |
| SMILES | Cc1cc(C(O)[C@H]2O[C@@H](n3ccc4c(Cl)ncnc43)[C@@H]3OC(C)(C)O[C@]23C)ccc1Cl |
| InChI | InChI=1S/C22H23Cl2N3O4/c1-11-9-12(5-6-14(11)23)15(28)16-22(4)17(30-21(2,3)31-22)20(29-16)27-8-7-13-18(24)25-10-26-19(13)27/h5-10,15-17,20,28H,1-4H3/t15?,16-,17+,20-,22-/m1/s1 |
| InChIKey | IRYADZLTJJOTCD-GLHHXHPMSA-N |
| XLogP | 4.59 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |