C18H20Cl2N4O5 — CID 137479691
(2R,3S,4R,5R)-2-[(4-chlorophenyl)-hydroxymethyl]-5-[4-(hydroxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3-methyloxolane-3,4-diol;hydrochloride (PubChem CID 137479691) has the molecular formula C18H20Cl2N4O5 and a molecular weight of 443.29 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[(4-chlorophenyl)-hydroxymethyl]-5-[4-(hydroxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3-methyloxolane-3,4-diol;hydrochloride.
| Compound Name | (2R,3S,4R,5R)-2-[(4-chlorophenyl)-hydroxymethyl]-5-[4-(hydroxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3-methyloxolane-3,4-diol;hydrochloride |
|---|---|
| PubChem CID | 137479691 |
| Molecular Formula | C18H20Cl2N4O5 |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | (2R,3S,4R,5R)-2-[(4-chlorophenyl)-hydroxymethyl]-5-[4-(hydroxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3-methyloxolane-3,4-diol;hydrochloride |
| SMILES | C[C@@]1(O)[C@@H](C(O)c2ccc(Cl)cc2)O[C@@H](n2ccc3c(NO)ncnc32)[C@@H]1O.Cl |
| InChI | InChI=1S/C18H19ClN4O5.ClH/c1-18(26)13(25)17(23-7-6-11-15(22-27)20-8-21-16(11)23)28-14(18)12(24)9-2-4-10(19)5-3-9;/h2-8,12-14,17,24-27H,1H3,(H,20,21,22);1H/t12?,13-,14+,17+,18-;/m0./s1 |
| InChIKey | LHZSILGIVHLGBD-ALXQSETESA-N |
| XLogP | 2.05 |
| TPSA | 132.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|