C19H18F4N4O4 — CID 137479677
(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[[4-fluoro-3-(trifluoromethyl)phenyl]-hydroxymethyl]-3-methyloxolane-3,4-diol (PubChem CID 137479677) has the molecular formula C19H18F4N4O4 and a molecular weight of 442.37 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[[4-fluoro-3-(trifluoromethyl)phenyl]-hydroxymethyl]-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[[4-fluoro-3-(trifluoromethyl)phenyl]-hydroxymethyl]-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 137479677 |
| Molecular Formula | C19H18F4N4O4 |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | (2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[[4-fluoro-3-(trifluoromethyl)phenyl]-hydroxymethyl]-3-methyloxolane-3,4-diol |
| SMILES | C[C@@]1(O)[C@@H](C(O)c2ccc(F)c(C(F)(F)F)c2)O[C@@H](n2ccc3c(N)ncnc32)[C@@H]1O |
| InChI | InChI=1S/C19H18F4N4O4/c1-18(30)13(29)17(27-5-4-9-15(24)25-7-26-16(9)27)31-14(18)12(28)8-2-3-11(20)10(6-8)19(21,22)23/h2-7,12-14,17,28-30H,1H3,(H2,24,25,26)/t12?,13-,14+,17+,18-/m0/s1 |
| InChIKey | NOWWVBFXXUUWKN-YKJFVLOVSA-N |
| XLogP | 1.91 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |