C19H20ClFN4O5 — CID 137479724
(2R,3S,4R,5R)-2-[(R)-(4-chloro-3-fluorophenyl)-hydroxymethyl]-5-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3-methyloxolane-3,4-diol (PubChem CID 137479724) has the molecular formula C19H20ClFN4O5 and a molecular weight of 438.84 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[(R)-(4-chloro-3-fluorophenyl)-hydroxymethyl]-5-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[(R)-(4-chloro-3-fluorophenyl)-hydroxymethyl]-5-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 137479724 |
| Molecular Formula | C19H20ClFN4O5 |
| Molecular Weight | 438.84 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | (2R,3S,4R,5R)-2-[(R)-(4-chloro-3-fluorophenyl)-hydroxymethyl]-5-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]-3-methyloxolane-3,4-diol |
| SMILES | CONc1ncnc2c1ccn2[C@@H]1O[C@H]([C@H](O)c2ccc(Cl)c(F)c2)[C@@](C)(O)[C@H]1O |
| InChI | InChI=1S/C19H20ClFN4O5/c1-19(28)14(27)18(25-6-5-10-16(24-29-2)22-8-23-17(10)25)30-15(19)13(26)9-3-4-11(20)12(21)7-9/h3-8,13-15,18,26-28H,1-2H3,(H,22,23,24)/t13-,14+,15-,18-,19+/m1/s1 |
| InChIKey | KYSOBKSGUMHEKO-MXQZZYIMSA-N |
| XLogP | 1.94 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.84 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|