C18H20Cl2N4O8S — CID 137479779
(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[(3,4-dichlorophenyl)-hydroxymethyl]-3-methyloxolane-3,4-diol;sulfuric acid (PubChem CID 137479779) has the molecular formula C18H20Cl2N4O8S and a molecular weight of 523.35 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[(3,4-dichlorophenyl)-hydroxymethyl]-3-methyloxolane-3,4-diol;sulfuric acid.
| Compound Name | (2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[(3,4-dichlorophenyl)-hydroxymethyl]-3-methyloxolane-3,4-diol;sulfuric acid |
|---|---|
| PubChem CID | 137479779 |
| Molecular Formula | C18H20Cl2N4O8S |
| Molecular Weight | 523.35 g/mol |
| Exact Mass | 522.04 |
| IUPAC Name | (2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[(3,4-dichlorophenyl)-hydroxymethyl]-3-methyloxolane-3,4-diol;sulfuric acid |
| SMILES | C[C@@]1(O)[C@@H](C(O)c2ccc(Cl)c(Cl)c2)O[C@@H](n2ccc3c(N)ncnc32)[C@@H]1O.O=S(=O)(O)O |
| InChI | InChI=1S/C18H18Cl2N4O4.H2O4S/c1-18(27)13(26)17(24-5-4-9-15(21)22-7-23-16(9)24)28-14(18)12(25)8-2-3-10(19)11(20)6-8;1-5(2,3)4/h2-7,12-14,17,25-27H,1H3,(H2,21,22,23);(H2,1,2,3,4)/t12?,13-,14+,17+,18-;/m0./s1 |
| InChIKey | FWACSSOIWNIGKF-ALXQSETESA-N |
| XLogP | 1.41 |
| TPSA | 201.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|