C18H17F3N4O4 — CID 166770868
(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[hydroxy-(2,3,5-trifluorophenyl)methyl]-3-methyloxolane-3,4-diol (PubChem CID 166770868) has the molecular formula C18H17F3N4O4 and a molecular weight of 410.35 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[hydroxy-(2,3,5-trifluorophenyl)methyl]-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[hydroxy-(2,3,5-trifluorophenyl)methyl]-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 166770868 |
| Molecular Formula | C18H17F3N4O4 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | (2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[hydroxy-(2,3,5-trifluorophenyl)methyl]-3-methyloxolane-3,4-diol |
| SMILES | C[C@@]1(O)[C@@H](C(O)c2cc(F)cc(F)c2F)O[C@@H](n2ccc3c(N)ncnc32)[C@@H]1O |
| InChI | InChI=1S/C18H17F3N4O4/c1-18(28)13(27)17(25-3-2-8-15(22)23-6-24-16(8)25)29-14(18)12(26)9-4-7(19)5-10(20)11(9)21/h2-6,12-14,17,26-28H,1H3,(H2,22,23,24)/t12?,13-,14+,17+,18-/m0/s1 |
| InChIKey | WUIPPUGFMOGYEO-YKJFVLOVSA-N |
| XLogP | 1.17 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|