C20H19F3N4O3 — CID 153401794
(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[1-[3-(difluoromethyl)-5-fluorophenyl]ethenyl]-3-methyloxolane-3,4-diol (PubChem CID 153401794) has the molecular formula C20H19F3N4O3 and a molecular weight of 420.39 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[1-[3-(difluoromethyl)-5-fluorophenyl]ethenyl]-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[1-[3-(difluoromethyl)-5-fluorophenyl]ethenyl]-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 153401794 |
| Molecular Formula | C20H19F3N4O3 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | (2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[1-[3-(difluoromethyl)-5-fluorophenyl]ethenyl]-3-methyloxolane-3,4-diol |
| SMILES | C=C(c1cc(F)cc(C(F)F)c1)[C@H]1O[C@@H](n2ccc3c(N)ncnc32)[C@H](O)[C@]1(C)O |
| InChI | InChI=1S/C20H19F3N4O3/c1-9(10-5-11(16(22)23)7-12(21)6-10)15-20(2,29)14(28)19(30-15)27-4-3-13-17(24)25-8-26-18(13)27/h3-8,14-16,19,28-29H,1H2,2H3,(H2,24,25,26)/t14-,15+,19+,20-/m0/s1 |
| InChIKey | ZXWRSWQMHFPNMT-BWMZKYQQSA-N |
| XLogP | 2.81 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |