C19H18Cl2N4O4 — CID 167109871
(2R)-2-[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-3-methyloxolan-2-yl]-2-(3,4-dichlorophenyl)acetaldehyde (PubChem CID 167109871) has the molecular formula C19H18Cl2N4O4 and a molecular weight of 437.28 g/mol. Its IUPAC name is (2R)-2-[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-3-methyloxolan-2-yl]-2-(3,4-dichlorophenyl)acetaldehyde.
| Compound Name | (2R)-2-[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-3-methyloxolan-2-yl]-2-(3,4-dichlorophenyl)acetaldehyde |
|---|---|
| PubChem CID | 167109871 |
| Molecular Formula | C19H18Cl2N4O4 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | (2R)-2-[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-3-methyloxolan-2-yl]-2-(3,4-dichlorophenyl)acetaldehyde |
| SMILES | C[C@@]1(O)[C@@H]([C@H](C=O)c2ccc(Cl)c(Cl)c2)O[C@@H](n2ccc3c(N)ncnc32)[C@@H]1O |
| InChI | InChI=1S/C19H18Cl2N4O4/c1-19(28)14(27)18(25-5-4-10-16(22)23-8-24-17(10)25)29-15(19)11(7-26)9-2-3-12(20)13(21)6-9/h2-8,11,14-15,18,27-28H,1H3,(H2,22,23,24)/t11-,14+,15-,18-,19+/m1/s1 |
| InChIKey | VLUOAZCPTLNOBT-OVBCXQRJSA-N |
| XLogP | 2.31 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|