C20H21F3N4O5 — CID 135307499
(2R,3S,4R,5R)-2-[hydroxy-[3-methyl-4-(trifluoromethyl)phenyl]methyl]-5-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol (PubChem CID 135307499) has the molecular formula C20H21F3N4O5 and a molecular weight of 454.41 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[hydroxy-[3-methyl-4-(trifluoromethyl)phenyl]methyl]-5-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[hydroxy-[3-methyl-4-(trifluoromethyl)phenyl]methyl]-5-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 135307499 |
| Molecular Formula | C20H21F3N4O5 |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | (2R,3S,4R,5R)-2-[hydroxy-[3-methyl-4-(trifluoromethyl)phenyl]methyl]-5-[4-(methoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol |
| SMILES | CONc1ncnc2c1ccn2[C@@H]1O[C@H](C(O)c2ccc(C(F)(F)F)c(C)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H21F3N4O5/c1-9-7-10(3-4-12(9)20(21,22)23)13(28)16-14(29)15(30)19(32-16)27-6-5-11-17(26-31-2)24-8-25-18(11)27/h3-8,13-16,19,28-30H,1-2H3,(H,24,25,26)/t13?,14-,15+,16+,19+/m0/s1 |
| InChIKey | LAEYVCMVWKYXNL-WZSIYOBSSA-N |
| XLogP | 2.08 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|