C20H21ClFN5O5 — CID 135317186
3-[7-[(2R,3R,4S,5R)-5-[(4-chloro-3-fluorophenyl)-hydroxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]-1,1-dimethylurea (PubChem CID 135317186) has the molecular formula C20H21ClFN5O5 and a molecular weight of 465.87 g/mol. Its IUPAC name is 3-[7-[(2R,3R,4S,5R)-5-[(4-chloro-3-fluorophenyl)-hydroxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]-1,1-dimethylurea.
| Compound Name | 3-[7-[(2R,3R,4S,5R)-5-[(4-chloro-3-fluorophenyl)-hydroxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 135317186 |
| Molecular Formula | C20H21ClFN5O5 |
| Molecular Weight | 465.87 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 3-[7-[(2R,3R,4S,5R)-5-[(4-chloro-3-fluorophenyl)-hydroxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1ncnc2c1ccn2[C@@H]1O[C@H](C(O)c2ccc(Cl)c(F)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H21ClFN5O5/c1-26(2)20(31)25-17-10-5-6-27(18(10)24-8-23-17)19-15(30)14(29)16(32-19)13(28)9-3-4-11(21)12(22)7-9/h3-8,13-16,19,28-30H,1-2H3,(H,23,24,25,31)/t13?,14-,15+,16+,19+/m0/s1 |
| InChIKey | RWJVZMBVMNZALH-WZSIYOBSSA-N |
| XLogP | 1.67 |
| TPSA | 132.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.87 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |